About ethane;3-methyl-5,6-dihydro-1H-indole
ethane;3-methyl-5,6-dihydro-1H-indole (PubChem CID 143453668) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydro-1H-indole.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6-dihydro-1H-indole |
| PubChem CID | 143453668 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;3-methyl-5,6-dihydro-1H-indole |
| SMILES | CC.Cc1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C9H11N.C2H6/c1-7-6-10-9-5-3-2-4-8(7)9;1-2/h4-6,10H,2-3H2,1H3;1-2H3 |
| InChIKey | YIZVGJUFZXBFMX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-methyl-5,6-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydro-1H-indole?
The IUPAC name of ethane;3-methyl-5,6-dihydro-1H-indole (CID 143453668) is ethane;3-methyl-5,6-dihydro-1H-indole.
What is the SMILES notation for ethane;3-methyl-5,6-dihydro-1H-indole?
The canonical SMILES for ethane;3-methyl-5,6-dihydro-1H-indole is CC.Cc1c[nH]c2c1=CCCC=2.
What is the InChIKey of ethane;3-methyl-5,6-dihydro-1H-indole?
The InChIKey is YIZVGJUFZXBFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C2H6/c1-7-6-10-9-5-3-2-4-8(7)9;1-2/h4-6,10H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydro-1H-indole?
ethane;3-methyl-5,6-dihydro-1H-indole has a molecular weight of 163.26 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydro-1H-indole is sourced from PubChem (CID 143453668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).