C25H25F3N2O4S — CID 143453838
S-[(Z)-1-[3-(1-ethyl-4,6-dimethyl-2-oxo-3,4-dihydroquinolin-7-yl)-4-(trifluoromethoxy)phenyl]-3-oxoprop-1-en-2-yl] N-methylcarbamothioate (PubChem CID 143453838) has the molecular formula C25H25F3N2O4S and a molecular weight of 506.55 g/mol. Its IUPAC name is S-[(Z)-1-[3-(1-ethyl-4,6-dimethyl-2-oxo-3,4-dihydroquinolin-7-yl)-4-(trifluoromethoxy)phenyl]-3-oxoprop-1-en-2-yl] N-methylcarbamothioate.
| Compound Name | S-[(Z)-1-[3-(1-ethyl-4,6-dimethyl-2-oxo-3,4-dihydroquinolin-7-yl)-4-(trifluoromethoxy)phenyl]-3-oxoprop-1-en-2-yl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 143453838 |
| Molecular Formula | C25H25F3N2O4S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | S-[(Z)-1-[3-(1-ethyl-4,6-dimethyl-2-oxo-3,4-dihydroquinolin-7-yl)-4-(trifluoromethoxy)phenyl]-3-oxoprop-1-en-2-yl] N-methylcarbamothioate |
| SMILES | CCN1C(=O)CC(C)c2cc(C)c(-c3cc(/C=C(/C=O)SC(=O)NC)ccc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C25H25F3N2O4S/c1-5-30-21-12-18(14(2)8-19(21)15(3)9-23(30)32)20-11-16(6-7-22(20)34-25(26,27)28)10-17(13-31)35-24(33)29-4/h6-8,10-13,15H,5,9H2,1-4H3,(H,29,33)/b17-10- |
| InChIKey | SYEUFSYYYCNDJS-YVLHZVERSA-N |
| XLogP | 6.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|