C29H29BrF3N3O2 — CID 143454228
N-(2-aminoethyl)-4-bromo-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]benzamide (PubChem CID 143454228) has the molecular formula C29H29BrF3N3O2 and a molecular weight of 588.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-bromo-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]benzamide.
| Compound Name | N-(2-aminoethyl)-4-bromo-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 143454228 |
| Molecular Formula | C29H29BrF3N3O2 |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | N-(2-aminoethyl)-4-bromo-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]benzamide |
| SMILES | NCCN(CC1CCC2C(O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H29BrF3N3O2/c30-21-9-6-19(7-10-21)28(37)36(15-14-34)17-22-11-12-23-26(18-4-2-1-3-5-18)35-25-13-8-20(29(31,32)33)16-24(25)27(23)38-22/h1-10,13,16,22-23,26-27,35H,11-12,14-15,17,34H2/t22?,23?,26-,27?/m0/s1 |
| InChIKey | OWVONUMPMBBONK-BNVHUODSSA-N |
| XLogP | 6.57 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |