C30H33F3N2O2S — CID 143454319
1-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol (PubChem CID 143454319) has the molecular formula C30H33F3N2O2S and a molecular weight of 542.67 g/mol. Its IUPAC name is 1-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol.
| Compound Name | 1-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 143454319 |
| Molecular Formula | C30H33F3N2O2S |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 1-[[(3R,5aR,6R,11bS)-6-phenyl-10-(trifluoromethyl)-1,3,4,5,5a,6,7,11b-octahydrooxepino[4,3-c]quinolin-3-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol |
| SMILES | OC1(c2cccs2)CCN(C[C@H]2CC[C@@H]3[C@H](CO2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C30H33F3N2O2S/c31-30(32,33)21-8-11-26-24(17-21)25-19-37-22(9-10-23(25)28(34-26)20-5-2-1-3-6-20)18-35-14-12-29(36,13-15-35)27-7-4-16-38-27/h1-8,11,16-17,22-23,25,28,34,36H,9-10,12-15,18-19H2/t22-,23-,25+,28+/m1/s1 |
| InChIKey | KZHYAQGSWXJHLN-HCVYWHBOSA-N |
| XLogP | 6.80 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |