About 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine
5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine (PubChem CID 143454366) has the molecular formula C18H30FN
and a molecular weight of 279.44 g/mol. Its IUPAC name is 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine.
Molecular Properties
| Compound Name | 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine |
| PubChem CID | 143454366 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine |
| SMILES | CCC(CCC(C)CN)C(C)c1cc(C)cc(F)c1C |
| InChI | InChI=1S/C18H30FN/c1-6-16(8-7-12(2)11-20)14(4)17-9-13(3)10-18(19)15(17)5/h9-10,12,14,16H,6-8,11,20H2,1-5H3 |
| InChIKey | QOSLSKQSTVVAQP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine?
The IUPAC name of 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine (CID 143454366) is 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine.
What is the SMILES notation for 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine?
The canonical SMILES for 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine is CCC(CCC(C)CN)C(C)c1cc(C)cc(F)c1C.
What is the InChIKey of 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine?
The InChIKey is QOSLSKQSTVVAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30FN/c1-6-16(8-7-12(2)11-20)14(4)17-9-13(3)10-18(19)15(17)5/h9-10,12,14,16H,6-8,11,20H2,1-5H3.
What are the key properties of 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine?
5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine has a molecular weight of 279.44 g/mol, XLogP of 4.95, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-(3-fluoro-2,5-dimethylphenyl)-2-methylheptan-1-amine is sourced from PubChem (CID 143454366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).