C25H29F3N2O3 — CID 143454367
5-hydroxy-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]pentanamide (PubChem CID 143454367) has the molecular formula C25H29F3N2O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 5-hydroxy-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]pentanamide.
| Compound Name | 5-hydroxy-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 143454367 |
| Molecular Formula | C25H29F3N2O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-hydroxy-N-[[(5R)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]pentanamide |
| SMILES | O=C(CCCCO)NCC1CCC2C(O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H29F3N2O3/c26-25(27,28)17-9-12-21-20(14-17)24-19(23(30-21)16-6-2-1-3-7-16)11-10-18(33-24)15-29-22(32)8-4-5-13-31/h1-3,6-7,9,12,14,18-19,23-24,30-31H,4-5,8,10-11,13,15H2,(H,29,32)/t18?,19?,23-,24?/m0/s1 |
| InChIKey | KXSGPGFWLWQZOE-NFFPBDNPSA-N |
| XLogP | 4.99 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|