C19H20FNO3 — CID 143454396
(5R)-7-fluoro-2-(hydroxymethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-8-ol (PubChem CID 143454396) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is (5R)-7-fluoro-2-(hydroxymethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-8-ol.
| Compound Name | (5R)-7-fluoro-2-(hydroxymethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-8-ol |
|---|---|
| PubChem CID | 143454396 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (5R)-7-fluoro-2-(hydroxymethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-8-ol |
| SMILES | OCC1CCC2C(O1)c1ccc(O)c(F)c1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H20FNO3/c20-16-15(23)9-8-14-18(16)21-17(11-4-2-1-3-5-11)13-7-6-12(10-22)24-19(13)14/h1-5,8-9,12-13,17,19,21-23H,6-7,10H2/t12?,13?,17-,19?/m0/s1 |
| InChIKey | TYESCSNERIBWDS-UOSIIANKSA-N |
| XLogP | 3.53 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |