C22H24FNO2 — CID 143454488
[(2R,4aR,5R,10bR)-5-(4-fluorophenyl)-9-prop-2-enyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol (PubChem CID 143454488) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is [(2R,4aR,5R,10bR)-5-(4-fluorophenyl)-9-prop-2-enyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol.
| Compound Name | [(2R,4aR,5R,10bR)-5-(4-fluorophenyl)-9-prop-2-enyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 143454488 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [(2R,4aR,5R,10bR)-5-(4-fluorophenyl)-9-prop-2-enyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
| SMILES | C=CCc1ccc2c(c1)[C@@H]1O[C@@H](CO)CC[C@@H]1[C@H](c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C22H24FNO2/c1-2-3-14-4-11-20-19(12-14)22-18(10-9-17(13-25)26-22)21(24-20)15-5-7-16(23)8-6-15/h2,4-8,11-12,17-18,21-22,24-25H,1,3,9-10,13H2/t17-,18-,21+,22-/m1/s1 |
| InChIKey | RSIYRPMIWFIGFM-RPHTVSPISA-N |
| XLogP | 4.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|