About ethane;2-methoxy-N,N,6-trimethyloxan-4-amine
ethane;2-methoxy-N,N,6-trimethyloxan-4-amine (PubChem CID 143454744) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;2-methoxy-N,N,6-trimethyloxan-4-amine.
Molecular Properties
| Compound Name | ethane;2-methoxy-N,N,6-trimethyloxan-4-amine |
| PubChem CID | 143454744 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | ethane;2-methoxy-N,N,6-trimethyloxan-4-amine |
| SMILES | CC.COC1CC(N(C)C)CC(C)O1 |
| InChI | InChI=1S/C9H19NO2.C2H6/c1-7-5-8(10(2)3)6-9(11-4)12-7;1-2/h7-9H,5-6H2,1-4H3;1-2H3 |
| InChIKey | JEPZJDJSSDLYIP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methoxy-N,N,6-trimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-N,N,6-trimethyloxan-4-amine?
The IUPAC name of ethane;2-methoxy-N,N,6-trimethyloxan-4-amine (CID 143454744) is ethane;2-methoxy-N,N,6-trimethyloxan-4-amine.
What is the SMILES notation for ethane;2-methoxy-N,N,6-trimethyloxan-4-amine?
The canonical SMILES for ethane;2-methoxy-N,N,6-trimethyloxan-4-amine is CC.COC1CC(N(C)C)CC(C)O1.
What is the InChIKey of ethane;2-methoxy-N,N,6-trimethyloxan-4-amine?
The InChIKey is JEPZJDJSSDLYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.C2H6/c1-7-5-8(10(2)3)6-9(11-4)12-7;1-2/h7-9H,5-6H2,1-4H3;1-2H3.
What are the key properties of ethane;2-methoxy-N,N,6-trimethyloxan-4-amine?
ethane;2-methoxy-N,N,6-trimethyloxan-4-amine has a molecular weight of 203.33 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-N,N,6-trimethyloxan-4-amine is sourced from PubChem (CID 143454744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).