C32H64N2O3S — CID 143454763
(4S,5S,6R,7R,9R)-10-[[(3R,5R)-3-amino-5-methylheptan-2-yl]-methylamino]-6-(4-ethyl-6-methyloxan-2-yl)oxy-3,4,5,7,9-pentamethyl-7-sulfanyldecan-2-one (PubChem CID 143454763) has the molecular formula C32H64N2O3S and a molecular weight of 556.94 g/mol. Its IUPAC name is (4S,5S,6R,7R,9R)-10-[[(3R,5R)-3-amino-5-methylheptan-2-yl]-methylamino]-6-(4-ethyl-6-methyloxan-2-yl)oxy-3,4,5,7,9-pentamethyl-7-sulfanyldecan-2-one.
| Compound Name | (4S,5S,6R,7R,9R)-10-[[(3R,5R)-3-amino-5-methylheptan-2-yl]-methylamino]-6-(4-ethyl-6-methyloxan-2-yl)oxy-3,4,5,7,9-pentamethyl-7-sulfanyldecan-2-one |
|---|---|
| PubChem CID | 143454763 |
| Molecular Formula | C32H64N2O3S |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.46 |
| IUPAC Name | (4S,5S,6R,7R,9R)-10-[[(3R,5R)-3-amino-5-methylheptan-2-yl]-methylamino]-6-(4-ethyl-6-methyloxan-2-yl)oxy-3,4,5,7,9-pentamethyl-7-sulfanyldecan-2-one |
| SMILES | CCC1CC(C)OC(O[C@H]([C@@H](C)[C@H](C)C(C)C(C)=O)[C@](C)(S)C[C@@H](C)CN(C)C(C)[C@H](N)C[C@H](C)CC)C1 |
| InChI | InChI=1S/C32H64N2O3S/c1-13-20(3)15-29(33)26(9)34(12)19-21(4)18-32(11,38)31(25(8)23(6)24(7)27(10)35)37-30-17-28(14-2)16-22(5)36-30/h20-26,28-31,38H,13-19,33H2,1-12H3/t20-,21-,22?,23-,24?,25+,26?,28?,29-,30?,31-,32-/m1/s1 |
| InChIKey | BKCHWXPFBDWLEW-MUJCFVDPSA-N |
| XLogP | 7.22 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|