C16H21NO4 — CID 143454813
ethane;ethyl 8-(hydroxymethyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 143454813) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethane;ethyl 8-(hydroxymethyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethane;ethyl 8-(hydroxymethyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 143454813 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethane;ethyl 8-(hydroxymethyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CC.CCOC(=O)c1c[nH]c2c(CO)cc(C)cc2c1=O |
| InChI | InChI=1S/C14H15NO4.C2H6/c1-3-19-14(18)11-6-15-12-9(7-16)4-8(2)5-10(12)13(11)17;1-2/h4-6,16H,3,7H2,1-2H3,(H,15,17);1-2H3 |
| InChIKey | FJXGDFJMPMUNRE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |