C23H19ClF3N3O2S — CID 143455313
acetic acid;(5R)-7-chloro-5-naphthalen-1-yl-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-2-imine (PubChem CID 143455313) has the molecular formula C23H19ClF3N3O2S and a molecular weight of 493.94 g/mol. Its IUPAC name is acetic acid;(5R)-7-chloro-5-naphthalen-1-yl-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-2-imine.
| Compound Name | acetic acid;(5R)-7-chloro-5-naphthalen-1-yl-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-2-imine |
|---|---|
| PubChem CID | 143455313 |
| Molecular Formula | C23H19ClF3N3O2S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | acetic acid;(5R)-7-chloro-5-naphthalen-1-yl-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-2-imine |
| SMILES | CC(=O)O.[H]/N=C1\CS[C@H](c2cccc3ccccc23)c2cc(Cl)ccc2N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C21H15ClF3N3S.C2H4O2/c22-13-8-9-17-16(10-13)19(15-7-3-5-12-4-1-2-6-14(12)15)29-11-18(26)28(17)20(27)21(23,24)25;1-2(3)4/h1-10,19,26-27H,11H2;1H3,(H,3,4)/b26-18+,27-20+;/t19-;/m1./s1 |
| InChIKey | BWOOSPOFHHKRDD-NHMIELKNSA-N |
| XLogP | 6.74 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|