C16H14ClNOS2 — CID 143455789
(5S)-7-chloro-5-(2-methoxyphenyl)-1,5-dihydro-4,1-benzothiazepine-2-thione (PubChem CID 143455789) has the molecular formula C16H14ClNOS2 and a molecular weight of 335.88 g/mol. Its IUPAC name is (5S)-7-chloro-5-(2-methoxyphenyl)-1,5-dihydro-4,1-benzothiazepine-2-thione.
| Compound Name | (5S)-7-chloro-5-(2-methoxyphenyl)-1,5-dihydro-4,1-benzothiazepine-2-thione |
|---|---|
| PubChem CID | 143455789 |
| Molecular Formula | C16H14ClNOS2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (5S)-7-chloro-5-(2-methoxyphenyl)-1,5-dihydro-4,1-benzothiazepine-2-thione |
| SMILES | COc1ccccc1[C@H]1SCC(=S)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClNOS2/c1-19-14-5-3-2-4-11(14)16-12-8-10(17)6-7-13(12)18-15(20)9-21-16/h2-8,16H,9H2,1H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | GWKYQFXUILOFDH-MRXNPFEDSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|