C27H30ClF3N2O5 — CID 143455918
(7R)-8-chloro-7-(2,3-dimethoxyphenyl)-2,5-dimethyl-1-(trifluoromethyl)-5,7-dihydro-3H-pyrimido[1,2-a][4,1]benzoxazepine;ethyl acetate (PubChem CID 143455918) has the molecular formula C27H30ClF3N2O5 and a molecular weight of 554.99 g/mol. Its IUPAC name is (7R)-8-chloro-7-(2,3-dimethoxyphenyl)-2,5-dimethyl-1-(trifluoromethyl)-5,7-dihydro-3H-pyrimido[1,2-a][4,1]benzoxazepine;ethyl acetate.
| Compound Name | (7R)-8-chloro-7-(2,3-dimethoxyphenyl)-2,5-dimethyl-1-(trifluoromethyl)-5,7-dihydro-3H-pyrimido[1,2-a][4,1]benzoxazepine;ethyl acetate |
|---|---|
| PubChem CID | 143455918 |
| Molecular Formula | C27H30ClF3N2O5 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (7R)-8-chloro-7-(2,3-dimethoxyphenyl)-2,5-dimethyl-1-(trifluoromethyl)-5,7-dihydro-3H-pyrimido[1,2-a][4,1]benzoxazepine;ethyl acetate |
| SMILES | CCOC(C)=O.COc1cccc([C@H]2OC(C)C3=NCC(C)=C(C(F)(F)F)N3c3cccc(Cl)c32)c1OC |
| InChI | InChI=1S/C23H22ClF3N2O3.C4H8O2/c1-12-11-28-22-13(2)32-20(14-7-5-10-17(30-3)19(14)31-4)18-15(24)8-6-9-16(18)29(22)21(12)23(25,26)27;1-3-6-4(2)5/h5-10,13,20H,11H2,1-4H3;3H2,1-2H3/t13?,20-;/m1./s1 |
| InChIKey | QDJZLNXNNOSGGR-FIMFEZLSSA-N |
| XLogP | 6.49 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |