C30H39ClF5NO2 — CID 143456017
(5R)-1-(3-chloro-3,3-difluoroprop-1-en-2-yl)-5-(3-methoxy-2-methylphenyl)-2-methylidene-7-(trifluoromethyl)-5H-4,1-benzoxazepine;ethane;hexane (PubChem CID 143456017) has the molecular formula C30H39ClF5NO2 and a molecular weight of 576.09 g/mol. Its IUPAC name is (5R)-1-(3-chloro-3,3-difluoroprop-1-en-2-yl)-5-(3-methoxy-2-methylphenyl)-2-methylidene-7-(trifluoromethyl)-5H-4,1-benzoxazepine;ethane;hexane.
| Compound Name | (5R)-1-(3-chloro-3,3-difluoroprop-1-en-2-yl)-5-(3-methoxy-2-methylphenyl)-2-methylidene-7-(trifluoromethyl)-5H-4,1-benzoxazepine;ethane;hexane |
|---|---|
| PubChem CID | 143456017 |
| Molecular Formula | C30H39ClF5NO2 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (5R)-1-(3-chloro-3,3-difluoroprop-1-en-2-yl)-5-(3-methoxy-2-methylphenyl)-2-methylidene-7-(trifluoromethyl)-5H-4,1-benzoxazepine;ethane;hexane |
| SMILES | C=C1CO[C@H](c2cccc(OC)c2C)c2cc(C(F)(F)F)ccc2N1C(=C)C(F)(F)Cl.CC.CCCCCC |
| InChI | InChI=1S/C22H19ClF5NO2.C6H14.C2H6/c1-12-11-31-20(16-6-5-7-19(30-4)13(16)2)17-10-15(22(26,27)28)8-9-18(17)29(12)14(3)21(23,24)25;1-3-5-6-4-2;1-2/h5-10,20H,1,3,11H2,2,4H3;3-6H2,1-2H3;1-2H3/t20-;;/m1../s1 |
| InChIKey | HWJQIQDZCZQAHN-FAVHNTAZSA-N |
| XLogP | 10.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|