About 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one
3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one (PubChem CID 143456770) has the molecular formula C13H14BrNO3
and a molecular weight of 312.16 g/mol. Its IUPAC name is 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one.
Molecular Properties
| Compound Name | 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one |
| PubChem CID | 143456770 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one |
| SMILES | COc1nc2c(cc1Br)C1(CCCCC1)OC2=O |
| InChI | InChI=1S/C13H14BrNO3/c1-17-11-9(14)7-8-10(15-11)12(16)18-13(8)5-3-2-4-6-13/h7H,2-6H2,1H3 |
| InChIKey | JFUCLLOOSOSLGR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one?
The IUPAC name of 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one (CID 143456770) is 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one.
What is the SMILES notation for 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one?
The canonical SMILES for 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one is COc1nc2c(cc1Br)C1(CCCCC1)OC2=O.
What is the InChIKey of 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one?
The InChIKey is JFUCLLOOSOSLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO3/c1-17-11-9(14)7-8-10(15-11)12(16)18-13(8)5-3-2-4-6-13/h7H,2-6H2,1H3.
What are the key properties of 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one?
3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one has a molecular weight of 312.16 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-bromo-2'-methoxyspiro[cyclohexane-1,5'-furo[3,4-b]pyridine]-7'-one is sourced from PubChem (CID 143456770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).