C27H28N6O — CID 143456920
N-[(E)-C-(aminomethyl)-N-[methyl(naphthalen-2-yl)amino]carbonimidoyl]-4-[(pyridin-3-ylmethylamino)methyl]benzamide (PubChem CID 143456920) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(E)-C-(aminomethyl)-N-[methyl(naphthalen-2-yl)amino]carbonimidoyl]-4-[(pyridin-3-ylmethylamino)methyl]benzamide.
| Compound Name | N-[(E)-C-(aminomethyl)-N-[methyl(naphthalen-2-yl)amino]carbonimidoyl]-4-[(pyridin-3-ylmethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 143456920 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[(E)-C-(aminomethyl)-N-[methyl(naphthalen-2-yl)amino]carbonimidoyl]-4-[(pyridin-3-ylmethylamino)methyl]benzamide |
| SMILES | CN(/N=C(\CN)NC(=O)c1ccc(CNCc2cccnc2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H28N6O/c1-33(25-13-12-22-6-2-3-7-24(22)15-25)32-26(16-28)31-27(34)23-10-8-20(9-11-23)17-30-19-21-5-4-14-29-18-21/h2-15,18,30H,16-17,19,28H2,1H3,(H,31,32,34) |
| InChIKey | SZUDXPAIOSWQEM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|