C15H24N4S — CID 143457264
3-piperazin-1-ylsulfanyl-N-[[(Z)-propylideneamino]methyl]cyclohepta-1,3,5-trien-1-amine (PubChem CID 143457264) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-piperazin-1-ylsulfanyl-N-[[(Z)-propylideneamino]methyl]cyclohepta-1,3,5-trien-1-amine.
| Compound Name | 3-piperazin-1-ylsulfanyl-N-[[(Z)-propylideneamino]methyl]cyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143457264 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-piperazin-1-ylsulfanyl-N-[[(Z)-propylideneamino]methyl]cyclohepta-1,3,5-trien-1-amine |
| SMILES | CC/C=N\CNC1=CC(SN2CCNCC2)=CC=CC1 |
| InChI | InChI=1S/C15H24N4S/c1-2-7-17-13-18-14-5-3-4-6-15(12-14)20-19-10-8-16-9-11-19/h3-4,6-7,12,16,18H,2,5,8-11,13H2,1H3/b17-7- |
| InChIKey | QMYFOVHUZGPDJZ-IDUWFGFVSA-N |
| XLogP | 2.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|