About (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane
(2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane (PubChem CID 143457398) has the molecular formula C12H16F2N2S
and a molecular weight of 258.34 g/mol. Its IUPAC name is (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane.
Molecular Properties
| Compound Name | (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane |
| PubChem CID | 143457398 |
| Molecular Formula | C12H16F2N2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane |
| SMILES | C=S(c1cc(F)c(C)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C12H16F2N2S/c1-9-7-11(14)12(8-10(9)13)17(2)16-5-3-15-4-6-16/h7-8,15H,2-6H2,1H3 |
| InChIKey | HPWFDOJNGZXOHM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane?
The IUPAC name of (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane (CID 143457398) is (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane.
What is the SMILES notation for (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane?
The canonical SMILES for (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane is C=S(c1cc(F)c(C)cc1F)N1CCNCC1.
What is the InChIKey of (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane?
The InChIKey is HPWFDOJNGZXOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2S/c1-9-7-11(14)12(8-10(9)13)17(2)16-5-3-15-4-6-16/h7-8,15H,2-6H2,1H3.
What are the key properties of (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane?
(2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane has a molecular weight of 258.34 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-difluoro-4-methylphenyl)-methylidene-piperazin-1-yl-λ4-sulfane is sourced from PubChem (CID 143457398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).