C23H23BrN4O — CID 143458493
7-(3-bromopropyl)-5-[(3-phenylmethoxyphenyl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 143458493) has the molecular formula C23H23BrN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is 7-(3-bromopropyl)-5-[(3-phenylmethoxyphenyl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-(3-bromopropyl)-5-[(3-phenylmethoxyphenyl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 143458493 |
| Molecular Formula | C23H23BrN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 7-(3-bromopropyl)-5-[(3-phenylmethoxyphenyl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(CCCBr)cc(Cc3cccc(OCc4ccccc4)c3)c12 |
| InChI | InChI=1S/C23H23BrN4O/c24-11-5-9-20-14-19(22-23(25)26-16-27-28(20)22)12-18-8-4-10-21(13-18)29-15-17-6-2-1-3-7-17/h1-4,6-8,10,13-14,16H,5,9,11-12,15H2,(H2,25,26,27) |
| InChIKey | UKNJVEYSNHCRGE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|