About 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane
5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane (PubChem CID 143458702) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane.
Molecular Properties
| Compound Name | 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane |
| PubChem CID | 143458702 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane |
| SMILES | CCOC.N#Cc1ccc(C=O)[nH]1 |
| InChI | InChI=1S/C6H4N2O.C3H8O/c7-3-5-1-2-6(4-9)8-5;1-3-4-2/h1-2,4,8H;3H2,1-2H3 |
| InChIKey | XSAQNTMXMKQPCR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane?
The IUPAC name of 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane (CID 143458702) is 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane.
What is the SMILES notation for 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane?
The canonical SMILES for 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane is CCOC.N#Cc1ccc(C=O)[nH]1.
What is the InChIKey of 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane?
The InChIKey is XSAQNTMXMKQPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O.C3H8O/c7-3-5-1-2-6(4-9)8-5;1-3-4-2/h1-2,4,8H;3H2,1-2H3.
What are the key properties of 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane?
5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane has a molecular weight of 180.21 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-1H-pyrrole-2-carbonitrile;methoxyethane is sourced from PubChem (CID 143458702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).