C16H18N2 — CID 143458986
1-benzyl-3-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole (PubChem CID 143458986) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole.
| Compound Name | 1-benzyl-3-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole |
|---|---|
| PubChem CID | 143458986 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-benzyl-3-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole |
| SMILES | C/C=C\C=C/c1cn(Cc2ccccc2)nc1C |
| InChI | InChI=1S/C16H18N2/c1-3-4-6-11-16-13-18(17-14(16)2)12-15-9-7-5-8-10-15/h3-11,13H,12H2,1-2H3/b4-3-,11-6- |
| InChIKey | ROYCJIRMCPLBAT-ZRTVSTLASA-N |
| XLogP | 3.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|