C15H25NO — CID 143459090
(2Z,4E)-2-(cyclohexa-1,5-dien-1-ylmethylamino)hepta-2,4-dienal;methane;molecular hydrogen (PubChem CID 143459090) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2Z,4E)-2-(cyclohexa-1,5-dien-1-ylmethylamino)hepta-2,4-dienal;methane;molecular hydrogen.
| Compound Name | (2Z,4E)-2-(cyclohexa-1,5-dien-1-ylmethylamino)hepta-2,4-dienal;methane;molecular hydrogen |
|---|---|
| PubChem CID | 143459090 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2Z,4E)-2-(cyclohexa-1,5-dien-1-ylmethylamino)hepta-2,4-dienal;methane;molecular hydrogen |
| SMILES | C.CC/C=C/C=C(/C=O)NCC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C14H19NO.CH4.H2/c1-2-3-5-10-14(12-16)15-11-13-8-6-4-7-9-13;;/h3,5-6,8-10,12,15H,2,4,7,11H2,1H3;1H4;1H/b5-3+,14-10-;; |
| InChIKey | BDGLYGZFGXBMOX-QUBUJULYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|