C20H29NO — CID 143459715
buta-1,3-diene;1-ethyl-2-methylindol-4-ol;2-methylbut-2-ene (PubChem CID 143459715) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is buta-1,3-diene;1-ethyl-2-methylindol-4-ol;2-methylbut-2-ene.
| Compound Name | buta-1,3-diene;1-ethyl-2-methylindol-4-ol;2-methylbut-2-ene |
|---|---|
| PubChem CID | 143459715 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | buta-1,3-diene;1-ethyl-2-methylindol-4-ol;2-methylbut-2-ene |
| SMILES | C=CC=C.CC=C(C)C.CCn1c(C)cc2c(O)cccc21 |
| InChI | InChI=1S/C11H13NO.C5H10.C4H6/c1-3-12-8(2)7-9-10(12)5-4-6-11(9)13;1-4-5(2)3;1-3-4-2/h4-7,13H,3H2,1-2H3;4H,1-3H3;3-4H,1-2H2 |
| InChIKey | OJCWTYIEWGNHNN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|