C24H25N3O8 — CID 143459867
2-[[2-[2-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]-3-oxaldehydoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetyl]amino]butanedioic acid (PubChem CID 143459867) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is 2-[[2-[2-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]-3-oxaldehydoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[2-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]-3-oxaldehydoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 143459867 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-[[2-[2-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]-3-oxaldehydoylpyrrolo[3,2-c]pyridin-4-yl]oxyacetyl]amino]butanedioic acid |
| SMILES | C/C=C\C=C/C=C/Cn1c(C)c(C(=O)C=O)c2c(OCC(=O)NC(CC(=O)O)C(=O)O)nccc21 |
| InChI | InChI=1S/C24H25N3O8/c1-3-4-5-6-7-8-11-27-15(2)21(18(29)13-28)22-17(27)9-10-25-23(22)35-14-19(30)26-16(24(33)34)12-20(31)32/h3-10,13,16H,11-12,14H2,1-2H3,(H,26,30)(H,31,32)(H,33,34)/b4-3-,6-5-,8-7+ |
| InChIKey | LTXUZHWONSAHHY-YUHUOFHPSA-N |
| XLogP | 1.84 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|