About (3E,4Z)-3,4-di(ethylidene)oxane;ethane
(3E,4Z)-3,4-di(ethylidene)oxane;ethane (PubChem CID 143460049) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (3E,4Z)-3,4-di(ethylidene)oxane;ethane.
Molecular Properties
| Compound Name | (3E,4Z)-3,4-di(ethylidene)oxane;ethane |
| PubChem CID | 143460049 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3E,4Z)-3,4-di(ethylidene)oxane;ethane |
| SMILES | C/C=C1/CCOC/C1=C/C.CC |
| InChI | InChI=1S/C9H14O.C2H6/c1-3-8-5-6-10-7-9(8)4-2;1-2/h3-4H,5-7H2,1-2H3;1-2H3/b8-3-,9-4-; |
| InChIKey | RTEXYZAXYWVXDJ-FLHNYSSYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,4Z)-3,4-di(ethylidene)oxane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-3,4-di(ethylidene)oxane;ethane?
The IUPAC name of (3E,4Z)-3,4-di(ethylidene)oxane;ethane (CID 143460049) is (3E,4Z)-3,4-di(ethylidene)oxane;ethane.
What is the SMILES notation for (3E,4Z)-3,4-di(ethylidene)oxane;ethane?
The canonical SMILES for (3E,4Z)-3,4-di(ethylidene)oxane;ethane is C/C=C1/CCOC/C1=C/C.CC.
What is the InChIKey of (3E,4Z)-3,4-di(ethylidene)oxane;ethane?
The InChIKey is RTEXYZAXYWVXDJ-FLHNYSSYSA-N. The full InChI is InChI=1S/C9H14O.C2H6/c1-3-8-5-6-10-7-9(8)4-2;1-2/h3-4H,5-7H2,1-2H3;1-2H3/b8-3-,9-4-;.
What are the key properties of (3E,4Z)-3,4-di(ethylidene)oxane;ethane?
(3E,4Z)-3,4-di(ethylidene)oxane;ethane has a molecular weight of 168.28 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3,4-di(ethylidene)oxane;ethane is sourced from PubChem (CID 143460049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).