C19H22N8S2 — CID 143460905
3-(1-ethylsulfanylpyrrolidin-3-yl)-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine (PubChem CID 143460905) has the molecular formula C19H22N8S2 and a molecular weight of 426.58 g/mol. Its IUPAC name is 3-(1-ethylsulfanylpyrrolidin-3-yl)-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine.
| Compound Name | 3-(1-ethylsulfanylpyrrolidin-3-yl)-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 143460905 |
| Molecular Formula | C19H22N8S2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-(1-ethylsulfanylpyrrolidin-3-yl)-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
| SMILES | CCSN1CCC(c2cc(Nc3nccn4c(-c5cnn(C)c5)cnc34)sn2)C1 |
| InChI | InChI=1S/C19H22N8S2/c1-3-28-26-6-4-13(12-26)15-8-17(29-24-15)23-18-19-21-10-16(27(19)7-5-20-18)14-9-22-25(2)11-14/h5,7-11,13H,3-4,6,12H2,1-2H3,(H,20,23) |
| InChIKey | BKMOLFMAVOJDBX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|