About 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane
1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane (PubChem CID 143461089) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane.
Molecular Properties
| Compound Name | 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane |
| PubChem CID | 143461089 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane |
| SMILES | CC.CC/C=C/N(C)NC |
| InChI | InChI=1S/C6H14N2.C2H6/c1-4-5-6-8(3)7-2;1-2/h5-7H,4H2,1-3H3;1-2H3/b6-5+; |
| InChIKey | PYNKCRVVNNLZPF-IPZCTEOASA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane?
The IUPAC name of 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane (CID 143461089) is 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane.
What is the SMILES notation for 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane?
The canonical SMILES for 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane is CC.CC/C=C/N(C)NC.
What is the InChIKey of 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane?
The InChIKey is PYNKCRVVNNLZPF-IPZCTEOASA-N. The full InChI is InChI=1S/C6H14N2.C2H6/c1-4-5-6-8(3)7-2;1-2/h5-7H,4H2,1-3H3;1-2H3/b6-5+;.
What are the key properties of 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane?
1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane has a molecular weight of 144.26 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-1-enyl]-1,2-dimethylhydrazine;ethane is sourced from PubChem (CID 143461089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).