About ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine
ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143461154) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 143461154 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC.COCCNc1nccn2ccnc12 |
| InChI | InChI=1S/C9H12N4O.C2H6/c1-14-7-4-11-8-9-12-3-6-13(9)5-2-10-8;1-2/h2-3,5-6H,4,7H2,1H3,(H,10,11);1-2H3 |
| InChIKey | BRVCMHBXYBFZIK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine (CID 143461154) is ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine is CC.COCCNc1nccn2ccnc12.
What is the InChIKey of ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is BRVCMHBXYBFZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O.C2H6/c1-14-7-4-11-8-9-12-3-6-13(9)5-2-10-8;1-2/h2-3,5-6H,4,7H2,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine?
ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 222.29 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 143461154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).