C24H35N3O5 — CID 143461834
3-cyclopropylpropyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate (PubChem CID 143461834) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is 3-cyclopropylpropyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate.
| Compound Name | 3-cyclopropylpropyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
|---|---|
| PubChem CID | 143461834 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 3-cyclopropylpropyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N(CC(=O)OCCCC1CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35N3O5/c1-5-15-26(22(29)25-17-20-10-7-6-8-11-20)27(23(30)32-24(2,3)4)18-21(28)31-16-9-12-19-13-14-19/h5-8,10-11,19H,1,9,12-18H2,2-4H3,(H,25,29) |
| InChIKey | WSNYORMGJNLEHO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|