C17H25N3O7S — CID 143461911
2-[2-acetyloxyethyl-(3-carbamimidoyl-4-ethoxyphenyl)sulfonylamino]ethyl acetate (PubChem CID 143461911) has the molecular formula C17H25N3O7S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[2-acetyloxyethyl-(3-carbamimidoyl-4-ethoxyphenyl)sulfonylamino]ethyl acetate.
| Compound Name | 2-[2-acetyloxyethyl-(3-carbamimidoyl-4-ethoxyphenyl)sulfonylamino]ethyl acetate |
|---|---|
| PubChem CID | 143461911 |
| Molecular Formula | C17H25N3O7S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[2-acetyloxyethyl-(3-carbamimidoyl-4-ethoxyphenyl)sulfonylamino]ethyl acetate |
| SMILES | [H]/N=C(\N)c1cc(S(=O)(=O)N(CCOC(C)=O)CCOC(C)=O)ccc1OCC |
| InChI | InChI=1S/C17H25N3O7S/c1-4-25-16-6-5-14(11-15(16)17(18)19)28(23,24)20(7-9-26-12(2)21)8-10-27-13(3)22/h5-6,11H,4,7-10H2,1-3H3,(H3,18,19) |
| InChIKey | DXLKHFZWAWMLEB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 149.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|