About 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane
3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane (PubChem CID 143461941) has the molecular formula C18H20ClN3OS
and a molecular weight of 361.90 g/mol. Its IUPAC name is 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane.
Molecular Properties
| Compound Name | 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane |
| PubChem CID | 143461941 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane |
| SMILES | CC.Nc1cccc(CN2N=C(c3ccc(Cl)cc3)CSC2=O)c1 |
| InChI | InChI=1S/C16H14ClN3OS.C2H6/c17-13-6-4-12(5-7-13)15-10-22-16(21)20(19-15)9-11-2-1-3-14(18)8-11;1-2/h1-8H,9-10,18H2;1-2H3 |
| InChIKey | IUGPOESYWUAEPH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane?
The IUPAC name of 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane (CID 143461941) is 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane.
What is the SMILES notation for 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane?
The canonical SMILES for 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane is CC.Nc1cccc(CN2N=C(c3ccc(Cl)cc3)CSC2=O)c1.
What is the InChIKey of 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane?
The InChIKey is IUGPOESYWUAEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3OS.C2H6/c17-13-6-4-12(5-7-13)15-10-22-16(21)20(19-15)9-11-2-1-3-14(18)8-11;1-2/h1-8H,9-10,18H2;1-2H3.
What are the key properties of 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane?
3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane has a molecular weight of 361.90 g/mol, XLogP of 5.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-aminophenyl)methyl]-5-(4-chlorophenyl)-6H-1,3,4-thiadiazin-2-one;ethane is sourced from PubChem (CID 143461941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).