C24H28FN3O2 — CID 143464133
(E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol (PubChem CID 143464133) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is (E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol.
| Compound Name | (E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol |
|---|---|
| PubChem CID | 143464133 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol |
| SMILES | Cc1cccc(NC2=NC=CCC(C3C=C(F)C=C(OCC/C=C/CO)CC3)=N2)c1 |
| InChI | InChI=1S/C24H28FN3O2/c1-18-7-5-8-21(15-18)27-24-26-12-6-9-23(28-24)19-10-11-22(17-20(25)16-19)30-14-4-2-3-13-29/h2-3,5-8,12,15-17,19,29H,4,9-11,13-14H2,1H3,(H,26,27)/b3-2+ |
| InChIKey | PDZYLTWDOSOFHS-NSCUHMNNSA-N |
| XLogP | 5.22 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|