C30H44N4O3 — CID 143464220
ethane;(Z)-N-methyl-3-[(2E,14Z)-9-morpholin-4-yl-12,17-dioxa-3,5-diazatricyclo[16.4.1.16,10]tetracosa-1(23),2,6(24),7,9,14,18,21-octaen-2-yl]prop-1-en-1-amine;molecular hydrogen (PubChem CID 143464220) has the molecular formula C30H44N4O3 and a molecular weight of 508.71 g/mol. Its IUPAC name is ethane;(Z)-N-methyl-3-[(2E,14Z)-9-morpholin-4-yl-12,17-dioxa-3,5-diazatricyclo[16.4.1.16,10]tetracosa-1(23),2,6(24),7,9,14,18,21-octaen-2-yl]prop-1-en-1-amine;molecular hydrogen.
| Compound Name | ethane;(Z)-N-methyl-3-[(2E,14Z)-9-morpholin-4-yl-12,17-dioxa-3,5-diazatricyclo[16.4.1.16,10]tetracosa-1(23),2,6(24),7,9,14,18,21-octaen-2-yl]prop-1-en-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143464220 |
| Molecular Formula | C30H44N4O3 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | ethane;(Z)-N-methyl-3-[(2E,14Z)-9-morpholin-4-yl-12,17-dioxa-3,5-diazatricyclo[16.4.1.16,10]tetracosa-1(23),2,6(24),7,9,14,18,21-octaen-2-yl]prop-1-en-1-amine;molecular hydrogen |
| SMILES | CC.CN/C=C\C/C1=N\CNc2ccc(N3CCOCC3)c(c2)COC/C=C\COC2=CCC=CC1=C2.[H][H] |
| InChI | InChI=1S/C28H36N4O3.C2H6.H2/c1-29-12-6-9-27-23-7-2-3-8-26(20-23)35-16-5-4-15-34-21-24-19-25(30-22-31-27)10-11-28(24)32-13-17-33-18-14-32;1-2;/h2,4-8,10-12,19-20,29-30H,3,9,13-18,21-22H2,1H3;1-2H3;1H/b5-4-,12-6-,31-27+;; |
| InChIKey | BUWCREXZABXWMZ-BUIOLVSSSA-N |
| XLogP | 5.60 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|