C11H17NO — CID 143464322
(1E,3E,5Z)-3-(prop-2-enoxymethyl)hepta-1,3,5-trien-1-amine (PubChem CID 143464322) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1E,3E,5Z)-3-(prop-2-enoxymethyl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3E,5Z)-3-(prop-2-enoxymethyl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143464322 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1E,3E,5Z)-3-(prop-2-enoxymethyl)hepta-1,3,5-trien-1-amine |
| SMILES | C=CCOCC(/C=C/N)=C/C=C\C |
| InChI | InChI=1S/C11H17NO/c1-3-5-6-11(7-8-12)10-13-9-4-2/h3-8H,2,9-10,12H2,1H3/b5-3-,8-7+,11-6+ |
| InChIKey | IRPIMHQGMWNXIS-GWZUFSFUSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|