C29H37N5O — CID 143464418
(10E)-13,28-dimethyl-23-pyrrolidin-1-yl-7-oxa-13,20,22,26-tetrazatetracyclo[19.4.1.12,6.115,19]octacosa-1(26),3,5,10,15(27),16,18,21,23-nonaene (PubChem CID 143464418) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is (10E)-13,28-dimethyl-23-pyrrolidin-1-yl-7-oxa-13,20,22,26-tetrazatetracyclo[19.4.1.12,6.115,19]octacosa-1(26),3,5,10,15(27),16,18,21,23-nonaene.
| Compound Name | (10E)-13,28-dimethyl-23-pyrrolidin-1-yl-7-oxa-13,20,22,26-tetrazatetracyclo[19.4.1.12,6.115,19]octacosa-1(26),3,5,10,15(27),16,18,21,23-nonaene |
|---|---|
| PubChem CID | 143464418 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | (10E)-13,28-dimethyl-23-pyrrolidin-1-yl-7-oxa-13,20,22,26-tetrazatetracyclo[19.4.1.12,6.115,19]octacosa-1(26),3,5,10,15(27),16,18,21,23-nonaene |
| SMILES | CC1C2=CC=CC1C1=NC(=NC(N3CCCC3)=CC1)Nc1cccc(c1)CN(C)C/C=C\CCO2 |
| InChI | InChI=1S/C29H37N5O/c1-22-25-12-9-13-27(22)35-19-7-3-4-16-33(2)21-23-10-8-11-24(20-23)30-29-31-26(25)14-15-28(32-29)34-17-5-6-18-34/h3-4,8-13,15,20,22,25H,5-7,14,16-19,21H2,1-2H3,(H,30,32)/b4-3- |
| InChIKey | BQMSEGFUVAGNMP-ARJAWSKDSA-N |
| XLogP | 5.35 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|