C13H17FN4 — CID 143464547
2-[amino-[(Z)-2-amino-3,3-dimethylbut-1-enyl]amino]-4-fluorobenzonitrile (PubChem CID 143464547) has the molecular formula C13H17FN4 and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3,3-dimethylbut-1-enyl]amino]-4-fluorobenzonitrile.
| Compound Name | 2-[amino-[(Z)-2-amino-3,3-dimethylbut-1-enyl]amino]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 143464547 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3,3-dimethylbut-1-enyl]amino]-4-fluorobenzonitrile |
| SMILES | CC(C)(C)/C(N)=C/N(N)c1cc(F)ccc1C#N |
| InChI | InChI=1S/C13H17FN4/c1-13(2,3)12(16)8-18(17)11-6-10(14)5-4-9(11)7-15/h4-6,8H,16-17H2,1-3H3/b12-8- |
| InChIKey | IUSQEKSGQIMWMB-WQLSENKSSA-N |
| XLogP | 2.22 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|