C24H28N8OS — CID 143465132
N,N,3-trimethyl-5-[[3-(2-methyl-3H-pyridazin-5-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide (PubChem CID 143465132) has the molecular formula C24H28N8OS and a molecular weight of 476.61 g/mol. Its IUPAC name is N,N,3-trimethyl-5-[[3-(2-methyl-3H-pyridazin-5-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide.
| Compound Name | N,N,3-trimethyl-5-[[3-(2-methyl-3H-pyridazin-5-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143465132 |
| Molecular Formula | C24H28N8OS |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N,N,3-trimethyl-5-[[3-(2-methyl-3H-pyridazin-5-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide |
| SMILES | Cc1cc(Nc2nc(C3=CCCNC3)cn3c(C4=CCN(C)N=C4)cnc23)sc1C(=O)N(C)C |
| InChI | InChI=1S/C24H28N8OS/c1-15-10-20(34-21(15)24(33)30(2)3)29-22-23-26-13-19(17-7-9-31(4)27-12-17)32(23)14-18(28-22)16-6-5-8-25-11-16/h6-7,10,12-14,25H,5,8-9,11H2,1-4H3,(H,28,29) |
| InChIKey | XPEAUIJMIAOVEX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |