C20H16N8OS — CID 143465268
8-(4-imidazol-1-ylanilino)-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-6-carbothioic S-acid (PubChem CID 143465268) has the molecular formula C20H16N8OS and a molecular weight of 416.47 g/mol. Its IUPAC name is 8-(4-imidazol-1-ylanilino)-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-6-carbothioic S-acid.
| Compound Name | 8-(4-imidazol-1-ylanilino)-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-6-carbothioic S-acid |
|---|---|
| PubChem CID | 143465268 |
| Molecular Formula | C20H16N8OS |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 8-(4-imidazol-1-ylanilino)-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-6-carbothioic S-acid |
| SMILES | Cn1cc(-c2cnc3c(Nc4ccc(-n5ccnc5)cc4)nc(C(=O)S)cn23)cn1 |
| InChI | InChI=1S/C20H16N8OS/c1-26-10-13(8-23-26)17-9-22-19-18(25-16(20(29)30)11-28(17)19)24-14-2-4-15(5-3-14)27-7-6-21-12-27/h2-12H,1H3,(H,24,25)(H,29,30) |
| InChIKey | MZBCQLLXWFWZQJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|