C9H10N2O2 — CID 143465382
6-ethenyl-5-[(Z)-prop-1-enyl]-1H-pyrimidine-2,4-dione (PubChem CID 143465382) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-ethenyl-5-[(Z)-prop-1-enyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-ethenyl-5-[(Z)-prop-1-enyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143465382 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-ethenyl-5-[(Z)-prop-1-enyl]-1H-pyrimidine-2,4-dione |
| SMILES | C=Cc1[nH]c(=O)[nH]c(=O)c1/C=C\C |
| InChI | InChI=1S/C9H10N2O2/c1-3-5-6-7(4-2)10-9(13)11-8(6)12/h3-5H,2H2,1H3,(H2,10,11,12,13)/b5-3- |
| InChIKey | KTDWWZXJVYNRLF-HYXAFXHYSA-N |
| XLogP | 0.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |