C16H25FN2S — CID 143465929
1-[2-[azepan-1-yl(dimethylidene)-λ6-sulfanyl]-4-fluorophenyl]-N-methylmethanamine (PubChem CID 143465929) has the molecular formula C16H25FN2S and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-[2-[azepan-1-yl(dimethylidene)-λ6-sulfanyl]-4-fluorophenyl]-N-methylmethanamine.
| Compound Name | 1-[2-[azepan-1-yl(dimethylidene)-λ6-sulfanyl]-4-fluorophenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 143465929 |
| Molecular Formula | C16H25FN2S |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[2-[azepan-1-yl(dimethylidene)-λ6-sulfanyl]-4-fluorophenyl]-N-methylmethanamine |
| SMILES | C=S(=C)(c1cc(F)ccc1CNC)N1CCCCCC1 |
| InChI | InChI=1S/C16H25FN2S/c1-18-13-14-8-9-15(17)12-16(14)20(2,3)19-10-6-4-5-7-11-19/h8-9,12,18H,2-7,10-11,13H2,1H3 |
| InChIKey | SKIAQRYIUSODGW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|