About methane;propane;9H-pyrido[3,2-b]azepine
methane;propane;9H-pyrido[3,2-b]azepine (PubChem CID 143466256) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is methane;propane;9H-pyrido[3,2-b]azepine.
Molecular Properties
| Compound Name | methane;propane;9H-pyrido[3,2-b]azepine |
| PubChem CID | 143466256 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | methane;propane;9H-pyrido[3,2-b]azepine |
| SMILES | C.C1=CCc2ncccc2N=C1.CCC |
| InChI | InChI=1S/C9H8N2.C3H8.CH4/c1-2-6-10-9-5-3-7-11-8(9)4-1;1-3-2;/h1-3,5-7H,4H2;3H2,1-2H3;1H4 |
| InChIKey | SRSSTISEACQGSJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;propane;9H-pyrido[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propane;9H-pyrido[3,2-b]azepine?
The IUPAC name of methane;propane;9H-pyrido[3,2-b]azepine (CID 143466256) is methane;propane;9H-pyrido[3,2-b]azepine.
What is the SMILES notation for methane;propane;9H-pyrido[3,2-b]azepine?
The canonical SMILES for methane;propane;9H-pyrido[3,2-b]azepine is C.C1=CCc2ncccc2N=C1.CCC.
What is the InChIKey of methane;propane;9H-pyrido[3,2-b]azepine?
The InChIKey is SRSSTISEACQGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C3H8.CH4/c1-2-6-10-9-5-3-7-11-8(9)4-1;1-3-2;/h1-3,5-7H,4H2;3H2,1-2H3;1H4.
What are the key properties of methane;propane;9H-pyrido[3,2-b]azepine?
methane;propane;9H-pyrido[3,2-b]azepine has a molecular weight of 204.32 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propane;9H-pyrido[3,2-b]azepine is sourced from PubChem (CID 143466256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).