About 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane
9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane (PubChem CID 143466331) has the molecular formula C26H28N4O
and a molecular weight of 412.54 g/mol. Its IUPAC name is 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane.
Molecular Properties
| Compound Name | 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane |
| PubChem CID | 143466331 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane |
| SMILES | CCCC.Cc1cccc(N)c1-c1nc2c3ccc(O)cc3c3cc(N)ccc3c2[nH]1 |
| InChI | InChI=1S/C22H18N4O.C4H10/c1-11-3-2-4-18(24)19(11)22-25-20-14-7-5-12(23)9-16(14)17-10-13(27)6-8-15(17)21(20)26-22;1-3-4-2/h2-10,27H,23-24H2,1H3,(H,25,26);3-4H2,1-2H3 |
| InChIKey | OWICTRPPQDWTOA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane?
The IUPAC name of 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane (CID 143466331) is 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane.
What is the SMILES notation for 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane?
The canonical SMILES for 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane is CCCC.Cc1cccc(N)c1-c1nc2c3ccc(O)cc3c3cc(N)ccc3c2[nH]1.
What is the InChIKey of 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane?
The InChIKey is OWICTRPPQDWTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O.C4H10/c1-11-3-2-4-18(24)19(11)22-25-20-14-7-5-12(23)9-16(14)17-10-13(27)6-8-15(17)21(20)26-22;1-3-4-2/h2-10,27H,23-24H2,1H3,(H,25,26);3-4H2,1-2H3.
What are the key properties of 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane?
9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane has a molecular weight of 412.54 g/mol, XLogP of 6.52, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-2-(2-amino-6-methylphenyl)-1H-phenanthro[9,10-d]imidazol-6-ol;butane is sourced from PubChem (CID 143466331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).