C13H21NS — CID 143466648
ethane;N-(1,2,3,4,6,7-hexahydronaphthalen-1-yl)methanethioamide (PubChem CID 143466648) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is ethane;N-(1,2,3,4,6,7-hexahydronaphthalen-1-yl)methanethioamide.
| Compound Name | ethane;N-(1,2,3,4,6,7-hexahydronaphthalen-1-yl)methanethioamide |
|---|---|
| PubChem CID | 143466648 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | ethane;N-(1,2,3,4,6,7-hexahydronaphthalen-1-yl)methanethioamide |
| SMILES | CC.S=CNC1CCCC2=CCCC=C21 |
| InChI | InChI=1S/C11H15NS.C2H6/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2/h4,6,8,11H,1-3,5,7H2,(H,12,13);1-2H3 |
| InChIKey | CVCIIQHMPFQFQW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|