About 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine
2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine (PubChem CID 143466930) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine |
| PubChem CID | 143466930 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine |
| SMILES | CC1=NC=CCC1CN1CCCCC1 |
| InChI | InChI=1S/C12H20N2/c1-11-12(6-5-7-13-11)10-14-8-3-2-4-9-14/h5,7,12H,2-4,6,8-10H2,1H3 |
| InChIKey | OHEPYEATWQVNTE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine?
The IUPAC name of 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine (CID 143466930) is 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine.
What is the SMILES notation for 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine?
The canonical SMILES for 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine is CC1=NC=CCC1CN1CCCCC1.
What is the InChIKey of 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine?
The InChIKey is OHEPYEATWQVNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-11-12(6-5-7-13-11)10-14-8-3-2-4-9-14/h5,7,12H,2-4,6,8-10H2,1H3.
What are the key properties of 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine?
2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine has a molecular weight of 192.31 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(piperidin-1-ylmethyl)-3,4-dihydropyridine is sourced from PubChem (CID 143466930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).