C15H25NO2S — CID 143467172
ethane;N-methoxy-N,5,5-trimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide (PubChem CID 143467172) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is ethane;N-methoxy-N,5,5-trimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide.
| Compound Name | ethane;N-methoxy-N,5,5-trimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 143467172 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethane;N-methoxy-N,5,5-trimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxamide |
| SMILES | CC.CON(C)C(=O)c1scc2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C13H19NO2S.C2H6/c1-13(2)6-5-10-9(7-13)8-17-11(10)12(15)14(3)16-4;1-2/h8H,5-7H2,1-4H3;1-2H3 |
| InChIKey | CXLYKNWBGLQGGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|