C24H38O3 — CID 143467201
(5E,8E,10E)-7-ethylidene-9,10-dimethoxy-3-methyltrideca-1,5,8,10-tetraen-4-one;(E)-hex-3-ene (PubChem CID 143467201) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (5E,8E,10E)-7-ethylidene-9,10-dimethoxy-3-methyltrideca-1,5,8,10-tetraen-4-one;(E)-hex-3-ene.
| Compound Name | (5E,8E,10E)-7-ethylidene-9,10-dimethoxy-3-methyltrideca-1,5,8,10-tetraen-4-one;(E)-hex-3-ene |
|---|---|
| PubChem CID | 143467201 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (5E,8E,10E)-7-ethylidene-9,10-dimethoxy-3-methyltrideca-1,5,8,10-tetraen-4-one;(E)-hex-3-ene |
| SMILES | C=CC(C)C(=O)/C=C/C(=CC)/C=C(OC)\C(=C/CC)OC.CC/C=C/CC |
| InChI | InChI=1S/C18H26O3.C6H12/c1-7-10-17(20-5)18(21-6)13-15(9-3)11-12-16(19)14(4)8-2;1-3-5-6-4-2/h8-14H,2,7H2,1,3-6H3;5-6H,3-4H2,1-2H3/b12-11+,15-9?,17-10+,18-13+;6-5+ |
| InChIKey | XOYAZELTAQTPRA-WHRVIUFSSA-N |
| XLogP | 6.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|