About N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane
N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane (PubChem CID 143467540) has the molecular formula C24H50N2
and a molecular weight of 366.68 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane |
| PubChem CID | 143467540 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane |
| SMILES | C.C=C(CCC)NCC1CCCCC1.CC(C)N(C)CC1CCCCC1 |
| InChI | InChI=1S/C12H23N.C11H23N.CH4/c1-3-7-11(2)13-10-12-8-5-4-6-9-12;1-10(2)12(3)9-11-7-5-4-6-8-11;/h12-13H,2-10H2,1H3;10-11H,4-9H2,1-3H3;1H4 |
| InChIKey | PHFGSYBWAPEKNV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane?
The IUPAC name of N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane (CID 143467540) is N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane.
What is the SMILES notation for N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane?
The canonical SMILES for N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane is C.C=C(CCC)NCC1CCCCC1.CC(C)N(C)CC1CCCCC1.
What is the InChIKey of N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane?
The InChIKey is PHFGSYBWAPEKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C11H23N.CH4/c1-3-7-11(2)13-10-12-8-5-4-6-9-12;1-10(2)12(3)9-11-7-5-4-6-8-11;/h12-13H,2-10H2,1H3;10-11H,4-9H2,1-3H3;1H4.
What are the key properties of N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane?
N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane has a molecular weight of 366.68 g/mol, XLogP of 7.01, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-N-methylpropan-2-amine;N-(cyclohexylmethyl)pent-1-en-2-amine;methane is sourced from PubChem (CID 143467540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).