C28H30Br2 — CID 143467671
2,8-bis(bromomethyl)-6,6,12,12-tetramethylindeno[1,2-b]fluorene;ethane (PubChem CID 143467671) has the molecular formula C28H30Br2 and a molecular weight of 526.36 g/mol. Its IUPAC name is 2,8-bis(bromomethyl)-6,6,12,12-tetramethylindeno[1,2-b]fluorene;ethane.
| Compound Name | 2,8-bis(bromomethyl)-6,6,12,12-tetramethylindeno[1,2-b]fluorene;ethane |
|---|---|
| PubChem CID | 143467671 |
| Molecular Formula | C28H30Br2 |
| Molecular Weight | 526.36 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2,8-bis(bromomethyl)-6,6,12,12-tetramethylindeno[1,2-b]fluorene;ethane |
| SMILES | CC.CC1(C)c2cc(CBr)ccc2-c2cc3c(cc21)-c1ccc(CBr)cc1C3(C)C |
| InChI | InChI=1S/C26H24Br2.C2H6/c1-25(2)21-9-15(13-27)5-7-17(21)19-12-24-20(11-23(19)25)18-8-6-16(14-28)10-22(18)26(24,3)4;1-2/h5-12H,13-14H2,1-4H3;1-2H3 |
| InChIKey | WBROVSANZZYGLD-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.36 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|