C22H26N4O2S — CID 143467998
2-[[(2S)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-[1-(pyridine-4-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazolidin-4-one (PubChem CID 143467998) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[[(2S)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-[1-(pyridine-4-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[(2S)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-[1-(pyridine-4-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143467998 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[(2S)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-[1-(pyridine-4-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3-thiazolidin-4-one |
| SMILES | CC1(C2=CCN(C(=O)c3ccncc3)CC2)S/C(=N/[C@H]2CC3CCC2C3)NC1=O |
| InChI | InChI=1S/C22H26N4O2S/c1-22(17-6-10-26(11-7-17)19(27)15-4-8-23-9-5-15)20(28)25-21(29-22)24-18-13-14-2-3-16(18)12-14/h4-6,8-9,14,16,18H,2-3,7,10-13H2,1H3,(H,24,25,28)/t14?,16?,18-,22?/m0/s1 |
| InChIKey | HBDBCFCMYFWGQW-HLJYRGCISA-N |
| XLogP | 3.02 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|